Inorganic Salts
Filtered Search Results
Copper(II) bromide, 99%
CAS: 7789-45-9 Molecular Formula: CuBr2 MDL Number: MFCD00010970 Synonym: Cupric bromide
| CAS | 7789-45-9 |
|---|---|
| MDL Number | MFCD00010970 |
| Synonym | Cupric bromide |
| Molecular Formula | CuBr2 |
Copper(II) acetate monohydrate, ACS reagent
CAS: 6046-93-1 Molecular Formula: C4H8CuO5 Molecular Weight (g/mol): 199.65 MDL Number: MFCD00149570 InChI Key: NWFNSTOSIVLCJA-UHFFFAOYSA-L Synonym: copper ii acetate monohydrate,cupric acetate monohydrate,copper diacetate monohydrate,copper acetate monohydrate,copper 2+ acetate, monohydrate,acetic acid, copper 2+ salt, monohydrate,verdigris,copper acetate hydrate,diacetoxycopper hydrate,copper acetate, hydrate PubChem CID: 165397 IUPAC Name: copper;diacetate;hydrate SMILES: O.[Cu++].CC([O-])=O.CC([O-])=O
| PubChem CID | 165397 |
|---|---|
| CAS | 6046-93-1 |
| Molecular Weight (g/mol) | 199.65 |
| MDL Number | MFCD00149570 |
| SMILES | O.[Cu++].CC([O-])=O.CC([O-])=O |
| Synonym | copper ii acetate monohydrate,cupric acetate monohydrate,copper diacetate monohydrate,copper acetate monohydrate,copper 2+ acetate, monohydrate,acetic acid, copper 2+ salt, monohydrate,verdigris,copper acetate hydrate,diacetoxycopper hydrate,copper acetate, hydrate |
| IUPAC Name | copper;diacetate;hydrate |
| InChI Key | NWFNSTOSIVLCJA-UHFFFAOYSA-L |
| Molecular Formula | C4H8CuO5 |
Potassium carbonate, 99+%, for analysis, anhydrous
CAS: 584-08-7 Molecular Formula: CK2O3 Molecular Weight (g/mol): 138.21 MDL Number: MFCD00011382 InChI Key: BWHMMNNQKKPAPP-UHFFFAOYSA-L Synonym: potassium carbonate,dipotassium carbonate,potash,potassium carbonate, anhydrous,carbonic acid, dipotassium salt,carbonate of potash,pearl ash,salt of tartar,kaliumcarbonat,potassiumcarbonate PubChem CID: 11430 SMILES: [K+].[K+].[O-]C([O-])=O
| PubChem CID | 11430 |
|---|---|
| CAS | 584-08-7 |
| Molecular Weight (g/mol) | 138.21 |
| MDL Number | MFCD00011382 |
| SMILES | [K+].[K+].[O-]C([O-])=O |
| Synonym | potassium carbonate,dipotassium carbonate,potash,potassium carbonate, anhydrous,carbonic acid, dipotassium salt,carbonate of potash,pearl ash,salt of tartar,kaliumcarbonat,potassiumcarbonate |
| InChI Key | BWHMMNNQKKPAPP-UHFFFAOYSA-L |
| Molecular Formula | CK2O3 |
Sodium Sulfate Anhydrous Granulated, 99.0%, MilliporeSigma™
CAS: 7757-82-6 Molecular Formula: Na2O4S Molecular Weight (g/mol): 142.04
| CAS | 7757-82-6 |
|---|---|
| Molecular Weight (g/mol) | 142.04 |
| Molecular Formula | Na2O4S |
Ammonium bromide, ACS reagent
CAS: 12124-97-9 Molecular Formula: BrH4N Molecular Weight (g/mol): 97.94 MDL Number: MFCD00011419 InChI Key: SWLVFNYSXGMGBS-UHFFFAOYSA-N IUPAC Name: ammonium bromide SMILES: [NH4+].[Br-]
| CAS | 12124-97-9 |
|---|---|
| Molecular Weight (g/mol) | 97.94 |
| MDL Number | MFCD00011419 |
| SMILES | [NH4+].[Br-] |
| IUPAC Name | ammonium bromide |
| InChI Key | SWLVFNYSXGMGBS-UHFFFAOYSA-N |
| Molecular Formula | BrH4N |
Potassium carbonate sesquihydrate, ACS, 98.5-101.0%
CAS: 6381-79-9 Molecular Formula: C2H6K4O9 Molecular Weight (g/mol): 330.45 MDL Number: MFCD00149925 InChI Key: WWVGGBSGYNQKCY-UHFFFAOYSA-J IUPAC Name: tetrapotassium trihydrate dicarbonate SMILES: O.O.O.[K+].[K+].[K+].[K+].[O-]C([O-])=O.[O-]C([O-])=O
| CAS | 6381-79-9 |
|---|---|
| Molecular Weight (g/mol) | 330.45 |
| MDL Number | MFCD00149925 |
| SMILES | O.O.O.[K+].[K+].[K+].[K+].[O-]C([O-])=O.[O-]C([O-])=O |
| IUPAC Name | tetrapotassium trihydrate dicarbonate |
| InChI Key | WWVGGBSGYNQKCY-UHFFFAOYSA-J |
| Molecular Formula | C2H6K4O9 |
Lead(II) nitrate, 99.999%, (trace metal basis)
CAS: 10099-74-8 Molecular Formula: N2O6Pb Molecular Weight (g/mol): 331.20 MDL Number: MFCD00011153 InChI Key: RLJMLMKIBZAXJO-UHFFFAOYSA-N Synonym: lead dinitrate,lead nitrate,lead ii nitrate,plumbous nitrate,lead 2+ nitrate,lead nitrate pb no3 2,nitrate de plomb french,lead ii nitrate 1:2,nitric acid, lead 2+ salt PubChem CID: 24924 ChEBI: CHEBI:37187 IUPAC Name: lead(2+);dinitrate SMILES: [Pb++].[O-][N+]([O-])=O.[O-][N+]([O-])=O
| PubChem CID | 24924 |
|---|---|
| CAS | 10099-74-8 |
| Molecular Weight (g/mol) | 331.20 |
| ChEBI | CHEBI:37187 |
| MDL Number | MFCD00011153 |
| SMILES | [Pb++].[O-][N+]([O-])=O.[O-][N+]([O-])=O |
| Synonym | lead dinitrate,lead nitrate,lead ii nitrate,plumbous nitrate,lead 2+ nitrate,lead nitrate pb no3 2,nitrate de plomb french,lead ii nitrate 1:2,nitric acid, lead 2+ salt |
| IUPAC Name | lead(2+);dinitrate |
| InChI Key | RLJMLMKIBZAXJO-UHFFFAOYSA-N |
| Molecular Formula | N2O6Pb |
Cerium(IV) sulfate, 95%
CAS: 13590-82-4 Molecular Formula: CeO8S2 Molecular Weight (g/mol): 332.23 MDL Number: MFCD00148852 InChI Key: VZDYWEUILIUIDF-UHFFFAOYSA-J Synonym: ceric sulfate,cerium iv sulfate,ceric disulfate,ceric sulphate,cerium disulfate,cerium 4+ sulfate,cerium 4+ disulphate,unii-4f66fi5t7x,sulfuric acid, cerium 4+ salt 2:1,cerium 4+ disulfate PubChem CID: 159684 IUPAC Name: cerium(4+);disulfate SMILES: [Ce+4].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O
| PubChem CID | 159684 |
|---|---|
| CAS | 13590-82-4 |
| Molecular Weight (g/mol) | 332.23 |
| MDL Number | MFCD00148852 |
| SMILES | [Ce+4].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O |
| Synonym | ceric sulfate,cerium iv sulfate,ceric disulfate,ceric sulphate,cerium disulfate,cerium 4+ sulfate,cerium 4+ disulphate,unii-4f66fi5t7x,sulfuric acid, cerium 4+ salt 2:1,cerium 4+ disulfate |
| IUPAC Name | cerium(4+);disulfate |
| InChI Key | VZDYWEUILIUIDF-UHFFFAOYSA-J |
| Molecular Formula | CeO8S2 |
Oxonic acid potassium salt
CAS: 2207-75-2 Molecular Formula: C4H2KN3O4 Molecular Weight (g/mol): 195.18 MDL Number: MFCD00010565 InChI Key: IAPCTXZQXAVYNG-UHFFFAOYSA-M Synonym: potassium oxonate,oteracil potassium,oxonic acid potassium salt,allantoxanic acid potassium salt,potassium azaorotate,oxonic acid, potassium salt,oxonate, potassium,oxonate,allantoxanic acid PubChem CID: 2723920 ChEBI: CHEBI:80230 SMILES: [K+].[O-]C(=O)C1=NC(=O)NC(=O)N1
| PubChem CID | 2723920 |
|---|---|
| CAS | 2207-75-2 |
| Molecular Weight (g/mol) | 195.18 |
| ChEBI | CHEBI:80230 |
| MDL Number | MFCD00010565 |
| SMILES | [K+].[O-]C(=O)C1=NC(=O)NC(=O)N1 |
| Synonym | potassium oxonate,oteracil potassium,oxonic acid potassium salt,allantoxanic acid potassium salt,potassium azaorotate,oxonic acid, potassium salt,oxonate, potassium,oxonate,allantoxanic acid |
| InChI Key | IAPCTXZQXAVYNG-UHFFFAOYSA-M |
| Molecular Formula | C4H2KN3O4 |
Cobalt(II) chloride, 97%, anhydrous
CAS: 7646-79-9 Molecular Formula: Cl2Co Molecular Weight (g/mol): 129.83 MDL Number: MFCD00010938 InChI Key: GVPFVAHMJGGAJG-UHFFFAOYSA-L Synonym: cobalt ii chloride,cobaltchloride,cobalt chloride 0.1 m solution,cobalt ii chloride, anhydrous,cobalt ii-chloride,curator_000013,cobalt chloride anhydrous,wln: co g2,cobalt-ii-chloride IUPAC Name: λ²-cobalt(2+) dichloride SMILES: [Cl-].[Cl-].[Co++]
| CAS | 7646-79-9 |
|---|---|
| Molecular Weight (g/mol) | 129.83 |
| MDL Number | MFCD00010938 |
| SMILES | [Cl-].[Cl-].[Co++] |
| Synonym | cobalt ii chloride,cobaltchloride,cobalt chloride 0.1 m solution,cobalt ii chloride, anhydrous,cobalt ii-chloride,curator_000013,cobalt chloride anhydrous,wln: co g2,cobalt-ii-chloride |
| IUPAC Name | λ²-cobalt(2+) dichloride |
| InChI Key | GVPFVAHMJGGAJG-UHFFFAOYSA-L |
| Molecular Formula | Cl2Co |
Lanthanum chloride heptahydrate, 99.99%, (trace metal basis)
CAS: 10025-84-0 Molecular Formula: Cl3H14LaO7 Molecular Weight (g/mol): 371.36 MDL Number: MFCD00149756 InChI Key: FDFPDGIMPRFRJP-UHFFFAOYSA-K IUPAC Name: lanthanum(3+) heptahydrate trichloride SMILES: O.O.O.O.O.O.O.[Cl-].[Cl-].[Cl-].[La+3]
| CAS | 10025-84-0 |
|---|---|
| Molecular Weight (g/mol) | 371.36 |
| MDL Number | MFCD00149756 |
| SMILES | O.O.O.O.O.O.O.[Cl-].[Cl-].[Cl-].[La+3] |
| IUPAC Name | lanthanum(3+) heptahydrate trichloride |
| InChI Key | FDFPDGIMPRFRJP-UHFFFAOYSA-K |
| Molecular Formula | Cl3H14LaO7 |
Sodium perchlorate monohydrate, ACS, 85.0-90.0%
CAS: 7-3-7791 Molecular Formula: ClH2NaO5 Molecular Weight (g/mol): 140.45 MDL Number: MFCD00149164 InChI Key: IXGNPUSUVRTQGW-UHFFFAOYSA-M Synonym: sodium perchlorate monohydrate,sodium perchlorate hydrate,unii-g4h485lhcw,g4h485lhcw,ccris 8893,perchloric acid, sodium salt, monohydrate,sodium hydrate perchlorate,clo4.na.h2o,acmc-1bii1,sodium perchlorate-monohydrate PubChem CID: 516899 IUPAC Name: sodium;perchlorate;hydrate SMILES: O.[O-]Cl(=O)(=O)=O.[Na+]
| PubChem CID | 516899 |
|---|---|
| CAS | 7-3-7791 |
| Molecular Weight (g/mol) | 140.45 |
| MDL Number | MFCD00149164 |
| SMILES | O.[O-]Cl(=O)(=O)=O.[Na+] |
| Synonym | sodium perchlorate monohydrate,sodium perchlorate hydrate,unii-g4h485lhcw,g4h485lhcw,ccris 8893,perchloric acid, sodium salt, monohydrate,sodium hydrate perchlorate,clo4.na.h2o,acmc-1bii1,sodium perchlorate-monohydrate |
| IUPAC Name | sodium;perchlorate;hydrate |
| InChI Key | IXGNPUSUVRTQGW-UHFFFAOYSA-M |
| Molecular Formula | ClH2NaO5 |
Osmium tetroxide, 2.5 wt.% solution in tert-Butanol, stabilized
CAS: 20816-12-0 | O4Os | 254.23 g/mol
| Linear Formula | OsO4 |
|---|---|
| Molecular Weight (g/mol) | 254.23 |
| InChI Key | VUVGYHUDAICLFK-UHFFFAOYSA-N |
| Density | 0.8110g/mL |
| PubChem CID | 30318 |
| Fieser | 01,759; 02,301; 04,361; 05,141; 06,424; 10,290; 12,358; 13,186; 14,235; 15,240; 16,249; 17,236 |
| RTECS Number | RN1140000 |
| Formula Weight | 254.2 |
| Color | White to Yellow |
| Physical Form | Crystals, Fused Mass or Solution |
| Chemical Name or Material | Osmium tetroxide |
| SMILES | O=[Os](=O)(=O)=O |
| Merck Index | 15, 6990 |
| Concentration or Composition (by Analyte or Components) | 2.5 wt% Min. |
| CAS | 75-65-0 |
| Health Hazard 3 | GHS P Statement Wear protective gloves/protective clothing/eye protection/face protection. Keep away from heat/sparks/open flames/hot surfaces. - No smoking. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rin |
| MDL Number | MFCD00011150 |
| Health Hazard 2 | GHS H Statement Toxic if inhaled. Harmful if swallowed. Fatal in contact with skin. Causes skin irritation. Causes serious eye irritation. May cause respiratory irritation. May cause allergy or asthma symptoms o |
| Packaging | Glass bottle |
| Flash Point | 4°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | osmium tetroxide,osmium tetraoxide,osmic acid,perosmic oxide,osmic acid anhydride,osmium viii oxide,oso4,perosmic acid anhydride,osmiumtetroxide,osmium oxide, t-4 |
| TSCA | TSCA |
| IUPAC Name | tetraoxoosmium |
| Molecular Formula | O4Os |
| EINECS Number | 244-058-7 |
| Specific Gravity | 0.811 |
Silver trifluoroacetate, 98%
CAS: 2966-50-9 Molecular Formula: C2AgF3O2 Molecular Weight (g/mol): 220.883 MDL Number: MFCD00013199 InChI Key: KZJPVUDYAMEDRM-UHFFFAOYSA-M Synonym: silver trifluoroacetate,silver 1+ trifluoroacetate,silver i 2,2,2-trifluoroacetate,silver mono trifluoroacetate,trifluoroacetic acid silver salt,silver 1+ ion trifluoroacetate,acetic acid, trifluoro-, silver 1+ salt,silver i trifluoroacetate,trifluoroacetic acid, silver salt,trifluoroacetic acid, silver 1+ salt PubChem CID: 76299 IUPAC Name: silver;2,2,2-trifluoroacetate SMILES: C(=O)(C(F)(F)F)[O-].[Ag+]
| PubChem CID | 76299 |
|---|---|
| CAS | 2966-50-9 |
| Molecular Weight (g/mol) | 220.883 |
| MDL Number | MFCD00013199 |
| SMILES | C(=O)(C(F)(F)F)[O-].[Ag+] |
| Synonym | silver trifluoroacetate,silver 1+ trifluoroacetate,silver i 2,2,2-trifluoroacetate,silver mono trifluoroacetate,trifluoroacetic acid silver salt,silver 1+ ion trifluoroacetate,acetic acid, trifluoro-, silver 1+ salt,silver i trifluoroacetate,trifluoroacetic acid, silver salt,trifluoroacetic acid, silver 1+ salt |
| IUPAC Name | silver;2,2,2-trifluoroacetate |
| InChI Key | KZJPVUDYAMEDRM-UHFFFAOYSA-M |
| Molecular Formula | C2AgF3O2 |
Potassium metabisulfite, 95+%
CAS: 16731-55-8 Molecular Formula: K2O5S2 Molecular Weight (g/mol): 222.31 MDL Number: MFCD00167605 InChI Key: RWPGFSMJFRPDDP-UHFFFAOYSA-L Synonym: potassium metabisulfite,potassium disulfite,potassium pyrosulfite,dipotassium disulfite,dipotassium pyrosulfite,dipotassium metabisulfite,dipotassium disulphite,unii-65oe787q7w,ccris 1427,potassium disulfite k2s2o5 PubChem CID: 28019 IUPAC Name: dipotassium sulfinatosulfonate SMILES: [K+].[K+].[O-]S(=O)S([O-])(=O)=O
| PubChem CID | 28019 |
|---|---|
| CAS | 16731-55-8 |
| Molecular Weight (g/mol) | 222.31 |
| MDL Number | MFCD00167605 |
| SMILES | [K+].[K+].[O-]S(=O)S([O-])(=O)=O |
| Synonym | potassium metabisulfite,potassium disulfite,potassium pyrosulfite,dipotassium disulfite,dipotassium pyrosulfite,dipotassium metabisulfite,dipotassium disulphite,unii-65oe787q7w,ccris 1427,potassium disulfite k2s2o5 |
| IUPAC Name | dipotassium sulfinatosulfonate |
| InChI Key | RWPGFSMJFRPDDP-UHFFFAOYSA-L |
| Molecular Formula | K2O5S2 |